This compound is a chemical compound used primarily as a research reagent. It features an ester functional group and a cyclopentane ring, with a LogP of approximately 3.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1149760-04-2
1-isopropylcyclohexyl Methacrylate
monomer for polymer synthesis
Triethyl orthopropionate
Organic synthesis reagent
Glycidic acid
inhibitor of glycolate synthesis
2-Fluoro-3-(trifluoromethyl)benzoic acid
Research compound for Hammett equation studies
Ethyl 2-phenyl-2-((phenylcarbonothioyl)thio)acetate
Research reagent for RAFT polymerization
(1-propan-2-ylcyclopentyl) 2-methylprop-2-enoate
GPXHHBYETPIZOU-UHFFFAOYSA-N
CC(C)C1(CCCC1)OC(=O)C(=C)C
—