2-Fluoro-3-(trifluoromethyl)benzoic acid is a substituted benzoic acid derivative used in physical organic chemistry as a model compound for Hammett equation studies. Its structure, featuring both fluoro and trifluoromethyl substituents on the aromatic ring, makes it suitable for investigating the influence of electron-withdrawing groups on reaction rates and equilibria.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 115029-22-6
Ethyl 2-phenyl-2-((phenylcarbonothioyl)thio)acetate
Research reagent for RAFT polymerization
3-Nitroaniline-2,4,5,6-d4
deuterated research compound
2-nitrotoluene-3,4,5,6-d4
deuterated research compound
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine
Boronic acid ester for cross-coupling
2-fluoro-3-(trifluoromethyl)benzoic acid
XVEAMDNSCPPPCP-UHFFFAOYSA-N
C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)O
—