1-Succinimidyl-3'-pyrenebutyrate is a fluorescent labeling reagent. It consists of a pyrene fluorophore linked to an N-hydroxysuccinimide (NHS) ester reactive group, enabling covalent attachment to primary amines on biomolecules such as proteins or peptides.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 114932-60-4
Benzyltrimethylammonium dichloroiodate
Phase transfer catalyst
2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester
research compound
Triethyl orthopropionate
Organic synthesis reagent
Glycidic acid
inhibitor of glycolate synthesis
(2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate
YBNMDCCMCLUHBL-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCCC2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2