1-Thianthrenylboronic Acid is a research reagent used in boronic acid chemistry. It contains varying amounts of anhydride and features a polycyclic structure with two aromatic rings and a heterocycle.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 108847-76-3
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
Boron trifluoride etherate
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Thianthren
research compound for phosphorescence studies
Thianthren-2-ylboronic acid
research chemical
thianthren-1-ylboronic acid
FZEWPLIHPXGNTB-UHFFFAOYSA-N
B(C1=C2C(=CC=C1)SC3=CC=CC=C3S2)(O)O