(2S)-1,1,2-triphenylethane-1,2-diol is a chiral organic compound featuring two alcohol groups and three aromatic rings. It is primarily supplied as a research reagent for laboratory and synthetic chemistry applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 108998-83-0
Boron trifluoride etherate
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Fmoc-Pro-OSu
research reagent for peptide synthesis
3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid
research compound
(R)-(+)-2-hydroxy-1,2,2-triphenylethyl acetate
Pharmaceutical intermediate
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
(2S)-1,1,2-triphenylethane-1,2-diol
GWVWUZJOQHWMFB-IBGZPJMESA-N
C1=CC=C(C=C1)[C@@H](C(C2=CC=CC=C2)(C3=CC=CC=C3)O)O