This compound is a chiral pharmaceutical intermediate featuring a triphenylethanol core with an acetate ester group. Its primary significance lies in its use as a building block in the synthesis of more complex pharmaceutical molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 95061-47-5
3-Bromo-1H-pyrazol-5-amine
Pharmaceutical intermediate
3-amino-6-chloropyridine-2-carbonitrile
Pharmaceutical intermediate for synthesis
2'-DEOXYURIDINE
nucleoside pharmaceutical intermediate
3,4,5-Trimethoxyphenylacetic acid
pharmaceutical intermediate for phenethylamine synthesis
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
[(1R)-2-hydroxy-1,2,2-triphenylethyl] acetate
GXLZCXZLVDUDHP-OAQYLSRUSA-N
CC(=O)O[C@H](C1=CC=CC=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O
—