Thianthren-2-ylboronic acid is a boronic acid derivative of thianthrene, a sulfur-containing heterocyclic compound. It is typically used as a research chemical in laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 108847-21-8
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
Boron trifluoride etherate
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
Thianthren
research compound for phosphorescence studies
thianthren-2-ylboronic acid
GCSOJZMPHLRBMJ-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)SC3=CC=CC=C3S2)(O)O