This compound is a protected amino acid derivative featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and a side-chain modification with a hydroxy-dimethylcyclohexenone moiety. It is primarily used as a building block in solid-phase peptide synthesis.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 204777-78-6
FMOC-DAB(IVDDE)-OH
protected amino acid building block
Fmoc-D-Lys(Dde)-OH
protected amino acid for peptide synthesis
Fmoc-Lys(Dde)-OH
Protected amino acid for peptide synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]butanoic acid
peptide synthesis intermediate
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]hexanoic acid
LHJJUCZESVFWSO-MHZLTWQESA-N
CC(C)CC(=NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C4=C(CC(CC4=O)(C)C)O