This compound is a protected amino acid derivative used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the amino group and a tert-butyl group on the serine side chain, making it suitable for stepwise assembly of peptides in laboratory and manufacturing settings.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1676-75-1
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
Fmoc-Thr(tBu)-Thr(Psi(Me,Me)pro)-OH
Protected amino acid building block
1-(3-methoxypropyl)piperidin-4-one
pharmaceutical intermediate
1-(benzothiophen-4-yl)piperazine;dihydrochloride
pharmaceutical intermediate
3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoic acid
TXDGEONUWGOCJG-UHFFFAOYSA-N
CC(C)(C)OCC(C(=O)O)NC(=O)OCC1=CC=CC=C1