Fmoc-His(Trt)-Gly-OH is a protected peptide synthesis building block used in research and laboratory settings. It consists of an Fmoc-protected histidine residue with a trityl side-chain protecting group, coupled to a glycine unit, and is employed for the stepwise assembly of peptides.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1428125-83-0
N-Fmoc-N'-trityl-L-histidine
Protected amino acid for peptide synthesis
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-[1-(triphenylmethyl)-1H-imidazol-4-yl]propanoic acid
Protected amino acid for peptide synthesis
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
N,N-Dimethyl-L-Valine
Peptide synthesis building block
L-Sulforaphane
phase II detoxification enzyme inducer
COPPER(II) ETHYLACETOACETATE
copper complex for research
Rhodium(III) 2,4-pentanedionate
Research reagent and reference standard
Ruthenium(III) acetylacetonate
coordination chemistry research reagent
2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoyl]amino]acetic acid
XIYBDFKFNGHUIZ-LHEWISCISA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)NCC(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57