L-Cysteine-d2 is a deuterium-labeled form of the amino acid L-cysteine, specifically deuterated at the beta-carbon. It is primarily used as a research compound for studies involving metabolic tracing and protein labeling.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 130633-02-2
3-Bromo-5-fluorobenzotrifluoride
research reagent
Hexyl (amino(4-aminophenyl)methylene)carbamate hydrochloride
research compound
(3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid
Boronic acid building block
Bicyclo[2.2.1]hept-5-en-2-ol
chemical intermediate for synthesis
D-Cysteine hydrochloride
research compound
Cystein chloride
dough conditioner and nutritional supplement
L-cysteine
Flavor and nutrition additive
L-Cysteine hydrochloride monohydrate
flavor enhancer and nutritional supplement
(2R)-2-amino-3,3-dideuterio-3-sulfanylpropanoic acid
XUJNEKJLAYXESH-XFJCSJJYSA-N
[2H]C([2H])([C@@H](C(=O)O)N)S