N-Carbobenzyloxy-D-serine-beta-lactone is a chemical compound used as a pharmaceutical intermediate. It features a beta-lactone ring and a carbobenzyloxy protecting group, making it suitable for the synthesis of more complex pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-Carbobenzyloxy-D-serine-beta-lactone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
Cbz-D-Homoserine lactone
research compound
(2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane
pharmaceutical intermediate for protease inhibitors
1-bromo-2-methoxy-3-nitrobenzene
Pharmaceutical intermediate for research
Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite]
nucleoside phosphoramidite for oligonucleotide synthesis
Adenosine, N-benzoyl-5'-O-(bis(4-methoxyphenyl)phenylmethyl)-2'-deoxy-, 3'-(2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite)
phosphoramidite for oligonucleotide synthesis
(S)-BENZYL (2-OXOOXETAN-3-YL)CARBAMATE
research compound
benzyl N-[(3R)-2-oxooxetan-3-yl]carbamate
CWFZPRQDHIUBDO-SECBINFHSA-N
C1[C@H](C(=O)O1)NC(=O)OCC2=CC=CC=C2
N-Carbobenzyloxy-D-serine-beta-lactone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.