Cbz-D-Homoserine lactone is a research compound featuring a benzyloxycarbonyl (Cbz) protecting group attached to the D-isomer of homoserine lactone. Its structure includes an aromatic ring and an ester-containing heterocyclic lactone ring, making it a useful building block in peptide synthesis and organic chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 41088-89-5
N-Carbobenzyloxy-D-serine-beta-lactone
beta-lactone pharmaceutical intermediate
(S)-BENZYL (2-OXOOXETAN-3-YL)CARBAMATE
research compound
Lithium diisopropylamide
strong base in organic synthesis
Cyclopropylboronic acid
boronic acid research reagent
Ethyl carbazate
research compound
Dimethyl(2-oxo-4-phenylbutyl)phosphonate
research compound
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
benzyl N-[(3R)-2-oxooxolan-3-yl]carbamate
FKWDZIFOVOUDAG-SNVBAGLBSA-N
C1COC(=O)[C@@H]1NC(=O)OCC2=CC=CC=C2