This compound is a research compound containing an oxetan-2-one ring and a carbamate ester group. It is characterized by a molecular weight of 221.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 26054-60-4
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
Cbz-D-Homoserine lactone
research compound
(3aR,4R,5R,6aS)-Hexahydro-5-hydroxy-4-[(1E,3S)-3-hydroxy-1-octen-1-yl]-2H-cyclopenta[b]furan-2-one
Prostaglandin research compound
N-Acetyl-D-cysteine
Research compound for peptide synthesis
(25S,43S)-43-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-25-(tert-butoxycarbonyl)-2,2-dimethyl-4,23,28,37-tetraoxo-3,32,35-trioxa-24,29,38-triazatetratetracontan-44-oic acid
Research compound for peptide synthesis
4-Nitrophenylsulfur Pentafluoride
research compound
N-Carbobenzyloxy-D-serine-beta-lactone
beta-lactone pharmaceutical intermediate
benzyl N-[(3S)-2-oxooxetan-3-yl]carbamate
CWFZPRQDHIUBDO-VIFPVBQESA-N
C1[C@@H](C(=O)O1)NC(=O)OCC2=CC=CC=C2