This compound is a deuterated analogue of 1,2-dichloropropane, specifically labeled with six deuterium atoms. It is primarily used as an internal standard or tracer in analytical research, including mass spectrometry and nuclear magnetic resonance spectroscopy, to enable precise quantification and structural elucidation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93952-08-0
Di-n-butyl phthalate-d4
research compound
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
P,p'-DDT-d8
reference standard for analytical chemistry
P,p'-DDD-d8
isotopically labeled research compound
1,2-DICHLOROPROPANE
Chemical intermediate for chlorinated chemicals
1,2-dichloro-1,1,2,3,3,3-hexadeuteriopropane
KNKRKFALVUDBJE-LIDOUZCJSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])Cl)Cl