This compound is a deuterated analogue of 1,2-dichloropropane, specifically labeled with six deuterium atoms. It is primarily used as an internal standard or tracer in analytical research, including mass spectrometry and nuclear magnetic resonance spectroscopy, to enable precise quantification and structural elucidation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Propane-1,1,1,2,3,3-d6, 2,3-dichloro- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Di-n-butyl phthalate-d4
research compound
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
P,p'-DDT-d8
reference standard for analytical chemistry
P,p'-DDD-d8
isotopically labeled research compound
1,2-DICHLOROPROPANE
Chemical intermediate for chlorinated chemicals
1,2-dichloro-1,1,2,3,3,3-hexadeuteriopropane
KNKRKFALVUDBJE-LIDOUZCJSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])Cl)Cl
Propane-1,1,1,2,3,3-d6, 2,3-dichloro- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.