Benzo[k]fluoranthene-d12 is a deuterated analytical reference standard used in research and laboratory settings. It is the isotopically labeled form of benzo[k]fluoranthene, with all twelve hydrogen atoms replaced by deuterium, facilitating precise quantification in analytical chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93952-01-3
Fluoranthene-d10, 98 atom % D
deuterated research standard
Dibenzo[b,d]furan-d8
deuterated analytical standard
Propane-1,1,1,2,3,3-d6, 2,3-dichloro-
deuterated research standard
Di-n-butyl phthalate-d4
research compound
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[k]fluoranthene
HAXBIWFMXWRORI-AQZSQYOVSA-N
[2H]C1=C(C(=C2C(=C3C4=C(C(=C(C5=C4C(=C(C(=C5[2H])[2H])[2H])C3=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]