Fluoranthene-d10 is a deuterated research standard in which all ten hydrogen atoms of the fluoranthene molecule are replaced with deuterium (98 atom % D). It is primarily used as an isotopic internal standard in analytical chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93951-69-0
Benzo[k]fluoranthene-d12
Deuterated analytical reference standard
Phen-2,3,4,5-d4-ol, 6-chloro-
deuterated research compound
Phen-2,3,5-d3-ol, 4,6-dichloro-
deuterated analytical reference standard
2,4-Dinitrophenol-d3
Deuterium-labeled analytical reference standard
Phen-2,3,4,5-d4-ol, 6-nitro-
deuterated research standard
3-Bromofluoranthene
research chemical
Fluoranthen-3-ylboronic acid
Chemical synthesis reagent
1,2,3,4,5,6,7,8,9,10-decadeuteriofluoranthene
GVEPBJHOBDJJJI-LHNTUAQVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C4=C3C2=C(C(=C4[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]