This compound is a deuterated analytical reference standard, specifically a trideuterated form of 2,4-dichlorophenol. It is primarily used in laboratory research as a stable isotope-labeled standard for analytical chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Phen-2,3,5-d3-ol, 4,6-dichloro- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,4-Dinitrophenol-d3
Deuterium-labeled analytical reference standard
Phen-2,3,4,5-d4-ol, 6-nitro-
deuterated research standard
Phen-2,3,5,6-d4-ol, 4-nitro-
deuterated research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
2,4-DICHLOROPHENOL
Intermediate for herbicides and biocides
Phen-2,3,5-d3-ol, 4,6-dichloro-(CAS 93951-74-7)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2,4-dichloro-3,5,6-trideuteriophenol
HFZWRUODUSTPEG-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1O)Cl)[2H])Cl)[2H]
Phen-2,3,5-d3-ol, 4,6-dichloro- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.