This compound is a deuterium-labeled derivative of naphthalen-2-amine, where seven hydrogen atoms are replaced with deuterium. It is primarily used as an isotopically labeled research compound for analytical and tracer studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Naphthalen-1,3,4,5,6,7,8-d7-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methylamine-15N hydrochloride
Isotopically labeled research compound
Pyruvic acid-1-13C
Isotopically labeled research compound
3-O-Methyl Colterol-d9
Isotopically labeled research compound
N-(tert-Butoxycarbonyl)-L-alanine-1-13C
Isotopically labeled research compound
Acenaphthylene D8
deuterated internal standard for analytical chemistry
Benz[e]acephenanthrylene-d12
isotope-labeled reference standard
Benzo[k]fluoranthene-d12
Deuterated analytical reference standard
Dibenzo[b,d]furan-d8
deuterated analytical standard
2-Naphthalen-1,3,4,5,6,7,8-d7-amine(CAS 93951-94-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,3,4,5,6,7,8-heptadeuterionaphthalen-2-amine
JBIJLHTVPXGSAM-GSNKEKJESA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])N)[2H])[2H])[2H]
2-Naphthalen-1,3,4,5,6,7,8-d7-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.