3-O-Methyl Colterol-d9 is a deuterium-labeled research compound, structurally characterized as an aromatic amine with alcohol and ether functional groups. Its primary significance lies in its use as an isotopically labeled standard for analytical and laboratory research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1346599-83-4
N-(tert-Butoxycarbonyl)-L-alanine-1-13C
Isotopically labeled research compound
5-(4-HYDROXYPHENYL)-5-PHENYL-D5-HYDANTOIN-15N2
Isotopically labeled research compound
Methylamine-15N hydrochloride
Isotopically labeled research compound
9-beta-D-Ribofuranosyl-9H-purin-6-amine-15N
Isotopically labeled research compound
6-(Desmethyl)-7-methyl zolpidem
Reference standard for analytical testing
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
Rac N-Benzyl-N-desmethyl Tramadol-d3
deuterated analytical reference standard
(+/-)-N-Desmethyl Trifluoroacetotramadol-d3
research compound
4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]-2-methoxyphenol
WVGNWNYBARIPKQ-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C=C1)O)OC)O