3-O-Methyl Colterol-d9 is a deuterium-labeled research compound, structurally characterized as an aromatic amine with alcohol and ether functional groups. Its primary significance lies in its use as an isotopically labeled standard for analytical and laboratory research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-O-Methyl Colterol-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-(tert-Butoxycarbonyl)-L-alanine-1-13C
Isotopically labeled research compound
5-(4-HYDROXYPHENYL)-5-PHENYL-D5-HYDANTOIN-15N2
Isotopically labeled research compound
Methylamine-15N hydrochloride
Isotopically labeled research compound
9-beta-D-Ribofuranosyl-9H-purin-6-amine-15N
Isotopically labeled research compound
6-(Desmethyl)-7-methyl zolpidem
Reference standard for analytical testing
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
Rac N-Benzyl-N-desmethyl Tramadol-d3
deuterated analytical reference standard
(+/-)-N-Desmethyl Trifluoroacetotramadol-d3
research compound
4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]-2-methoxyphenol
WVGNWNYBARIPKQ-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C=C1)O)OC)O
3-O-Methyl Colterol-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.