Dimethyl phthalate-3,4,5,6-d4 is a deuterated analog of dimethyl phthalate, where four hydrogen atoms on the aromatic ring are replaced with deuterium. It is primarily used as an internal standard or labeled reference compound in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dimethyl phthalate-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 2-Hydroxybenzoate-3,4,5,6-d4
Isotope-labeled research standard
1,10-DECANE-D20-DIOL
Deuterated research standard
2-Bromopropane-d7
Deuterated research standard
3-PENTANONE-D10
Deuterated research standard
N-BUTYRALDEHYDE-D8
Deuterated research standard
3,3'-dichlorobenzidine-d6
research reagent or reference standard
2-Naphthalen-1,3,4,5,6,7,8-d7-amine
Isotopically labeled research compound
Acenaphthylene D8
deuterated internal standard for analytical chemistry
Dimethyl phthalate-3,4,5,6-d4(CAS 93951-89-4)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
dimethyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
NIQCNGHVCWTJSM-LNFUJOGGSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OC)C(=O)OC)[2H])[2H]
Dimethyl phthalate-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.