N-Butyraldehyde-d8 is a deuterated form of butyraldehyde where all eight hydrogen atoms are replaced with deuterium. It is primarily used as a deuterated research standard in analytical chemistry, serving as a stable isotope-labeled internal standard for mass spectrometry and nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-BUTYRALDEHYDE-D8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
25-Hydroxy Cholesterol-d6
Deuterated research standard
Dimethyl phthalate-3,4,5,6-d4
Deuterated research standard
2,2,3,3,3-pentadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)propan-1-one
Deuterated research standard
1,10-DECANE-D20-DIOL
Deuterated research standard
6-Methoxy-8-nitroquinoline
research compound
(Cyclopent-1-en-1-yl)boronic acid
Boronic acid building block
Lithium iodide (LiI), trihydrate
Laboratory reagent
(2S)-3-(dimethylamino)-1-(3-methoxyphenyl)-2-methyl-1-propanone
Research compound
1,2,2,3,3,4,4,4-octadeuteriobutan-1-one
ZTQSAGDEMFDKMZ-RIZALVEQSA-N
[2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
N-BUTYRALDEHYDE-D8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.