25-Hydroxy Cholesterol-d6 is a deuterated form of 25-hydroxycholesterol used as an internal standard in mass spectrometry-based analytical research. Its structure incorporates six deuterium atoms, providing a stable isotope-labeled reference compound for accurate quantification in biological and clinical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
25-Hydroxy Cholesterol-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Cholesterol-26,26,26,27,27,27-d6
deuterated cholesterol internal standard
Cholesterol
emulsifying agent in pharmaceuticals and cosmetics
Cholesterol-25,26,26,26,27,27,27-d7
labeled deuterated internal standard
Dimethyl phthalate-3,4,5,6-d4
Deuterated research standard
2,2,3,3,3-pentadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)propan-1-one
Deuterated research standard
1,10-DECANE-D20-DIOL
Deuterated research standard
2-Bromopropane-d7
Deuterated research standard
Methyl 2-amino-5-bromoisonicotinate
research reagent
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-7,7,7-trideuterio-6-hydroxy-6-(trideuteriomethyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
INBGSXNNRGWLJU-KHKDDIDZSA-N
[2H]C([2H])([2H])C(CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)(C([2H])([2H])[2H])O
25-Hydroxy Cholesterol-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.