Cholesterol-d7 is a deuterated form of cholesterol used as a labeled internal standard in analytical chemistry. Its primary significance lies in its role as a research reagent for quantitative mass spectrometry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cholesterol-25,26,26,26,27,27,27-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
25-Hydroxy Cholesterol-d6
Deuterated research standard
24(RS)-Hydroxycholesterol-d7
isotope-labeled research steroid standard
Pentafluorobenzenesulfonyl chloride
Research reagent
Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide
organophosphorus extractant for metal ions
3-Bromo-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Research chemical intermediate
1-(1,2-Oxazol-4-yl)ethan-1-one
Research compound
Epicholesterol-2,2,3,4,4,6-d6
deuterated analytical reference standard
Cholesterol-2,2,3,4,4,6-d6
Deuterated cholesterol reference standard
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6,7,7,7-tetradeuterio-6-(trideuteriomethyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
HVYWMOMLDIMFJA-IFAPJKRJSA-N
[2H]C([2H])([2H])C([2H])(CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C([2H])([2H])[2H]
Cholesterol-25,26,26,26,27,27,27-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.