2-Chloronaphthalene-d7 is a deuterated analytical reference standard used primarily in research and analytical chemistry. It consists of a chlorinated naphthalene molecule where all seven hydrogen atoms are replaced with deuterium, making it valuable for mass spectrometry and isotope-labeling studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93951-84-9
Dimethyl phthalate-3,4,5,6-d4
Deuterated research standard
3,3'-dichlorobenzidine-d6
research reagent or reference standard
2-Naphthalen-1,3,4,5,6,7,8-d7-amine
Isotopically labeled research compound
Acenaphthylene D8
deuterated internal standard for analytical chemistry
2-CHLORONAPHTHALENE
chlorinated naphthalene industrial chemical
2-chloro-1,3,4,5,6,7,8-heptadeuterionaphthalene
CGYGETOMCSJHJU-GSNKEKJESA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])Cl)[2H])[2H])[2H]