4-Chloro-3-nitrobenzonitrile is a chemical compound used as a research reagent. It features a benzene ring substituted with chloro, nitro, and nitrile groups, which contributes to its reactivity in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 939-80-0
Benzo[ghi]perylene-d12
Deuterated polycyclic aromatic hydrocarbon standard
Fluoranthene-d10, 98 atom % D
deuterated research standard
Phen-2,3,4,5-d4-ol, 6-chloro-
deuterated research compound
Phen-2,3,5-d3-ol, 4,6-dichloro-
deuterated analytical reference standard
4-chloro-3-nitrobenzonitrile
XBLPHYSLHRGMNW-UHFFFAOYSA-N
C1=CC(=C(C=C1C#N)[N+](=O)[O-])Cl