4-Methyl-3-nitrobenzonitrile is a research compound consisting of a benzene ring substituted with a methyl group, a nitro group, and a nitrile group. Its significance lies in its utility as a building block for chemical synthesis in laboratory and research settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Methyl-3-nitrobenzonitrile 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Chloro-3-nitrobenzonitrile
research compound
Benzo[ghi]perylene-d12
Deuterated polycyclic aromatic hydrocarbon standard
Fluoranthene-d10, 98 atom % D
deuterated research standard
Phen-2,3,4,5-d4-ol, 6-chloro-
deuterated research compound
4-methyl-3-nitrobenzonitrile
KOFBNBCOGKLUOM-UHFFFAOYSA-N
CC1=C(C=C(C=C1)C#N)[N+](=O)[O-]
4-Methyl-3-nitrobenzonitrile 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.