This compound is a protected amino acid derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a methoxy side chain. It is primarily used as an intermediate in the synthesis of peptides and other pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
(S)-2-Hydroxyethyl 2-amino-3-methylbutanoate 4-methylbenzenesulfonate
pharmaceutical intermediate for acyclovir impurities
Dienogest Impurity G
Pharmaceutical intermediate for dienogest
3-Fluoro-5-iodo-4-methylbenzoic acid
Pharmaceutical intermediate
1-(2,2-DIFLUOROBENZO[D][1,3]DIOXOL-5-YL)CYCLOPROPANECARBONITRILE
pharmaceutical intermediate
2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
Building block for peptide synthesis
(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
RFGMSGRWQUMJIR-ZCFIWIBFSA-N
CC(C)(C)OC(=O)N[C@H](COC)C(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.