Dienogest Impurity G is a steroidal compound containing alcohol, aromatic ring, and nitrile functional groups. It is primarily used as a pharmaceutical intermediate in the manufacturing process of dienogest.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dienogest Impurity G 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Fluoro-5-iodo-4-methylbenzoic acid
Pharmaceutical intermediate
1-(2,2-DIFLUOROBENZO[D][1,3]DIOXOL-5-YL)CYCLOPROPANECARBONITRILE
pharmaceutical intermediate
3-Bromo-4-chlorobenzaldehyde
Pharmaceutical intermediate
2-Propenoic acid, 2-[2-(ethenyloxy)ethoxy]ethyl ester
Pharmaceutical intermediate monomer
2-[(8S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]acetonitrile
LPEAVAOTAWKUPC-FUMNGEBKSA-N
C[C@]12CC=C3[C@H]([C@@H]1CC[C@]2(CC#N)O)CCC4=C3C=CC(=C4)O
Dienogest Impurity G 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.