This compound is a protected amino acid intermediate, specifically the dicyclohexylamine salt of Boc-Ser(tBu)-OH. It is primarily used in laboratory and manufacturing settings for peptide synthesis, where the tert-butyl and Boc groups provide temporary protection for the serine side chain and amino group, respectively.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Boc-ser(tbu)-oh dcha 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
Building block for peptide synthesis
(2R)-2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
pharmaceutical intermediate
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
N-Carbobenzoxy-L-glutamine
protected amino acid intermediate
N-[(Phenylmethoxy)carbonyl]-L-isoleucine
protected amino acid intermediate
H-His(Trt)-OH
protected amino acid intermediate
Sodium chlorodifluoroacetate
Pharmaceutical intermediate for synthesis
(S)-2-Methyl-1-(6-nitropyridin-3-yl)piperazine
pharmaceutical intermediate
N-cyclohexylcyclohexanamine;(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
AIEUUHIXSUNTGV-QRPNPIFTSA-N
CC(C)(C)OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C.C1CCC(CC1)NC2CCCCC2
Boc-ser(tbu)-oh dcha 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.