H-His(Trt)-OH, or N-trityl-L-histidine, is a protected amino acid derivative commonly used as a pharmaceutical intermediate. Its structure incorporates a trityl (triphenylmethyl) protecting group on the imidazole nitrogen of histidine, making it a versatile building block in peptide synthesis and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
H-His(Trt)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
3-Amino-N-((phenylmethoxy)carbonyl)-D-alanine
protected amino acid intermediate
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
N-Carbobenzoxy-L-glutamine
protected amino acid intermediate
Tert-Butyl (S)-2-carbamoylpyrrolidine-1-carboxylate
protected proline amide intermediate
2'-Hydroxy-3-phenylpropiophenone
Lisdexamfetamine intermediate
N-Ethyl-4-hydroxypiperidine
pharmaceutical intermediate
1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate
chiral reagent for resolution
(2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoic acid
BSZQZNOAYQCQFZ-QHCPKHFHSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)O)N
H-His(Trt)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.