1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate is a chiral compound used as a resolving agent in the separation of enantiomers. Its significance lies in its role as a chiral reagent for resolution in chemical synthesis and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 35193-64-7
4-Fluorobenzyl chloride
Pharmaceutical intermediate
2,2,2-TRIFLUOROETHYL METHACRYLATE
Pharmaceutical intermediate
1-boc-piperidin-3-yl-propionic acid
Pharmaceutical intermediate for peptide synthesis
3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carbonitrile
Pharmaceutical intermediate for synthesis
(R)-(-)-1,1'-Binaphthalene-2,2'-diyl hydrogen phosphate
chiral auxiliary for asymmetric synthesis
13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide
JEHUZVBIUCAMRZ-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=CC3=C2C4=C(C=CC5=CC=CC=C54)OP(=O)(O3)O