Fmoc-cys (acm) is a side-chain protected amino acid derivative used in solid-phase peptide synthesis. The Fmoc group protects the alpha-amino group while the acetamidomethyl (acm) group protects the thiol side chain of cysteine, enabling selective deprotection during peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fmoc-cys (acm) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
FMOC-CYS(ME)-OH
research reagent
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
(S)-(+)-3-Hydroxytetrahydrofuran
pharmaceutical intermediate
(R)-2-AMINO-3-METHOXYPROPANOIC ACID HYDROCHLORIDE
Pharmaceutical intermediate for peptide synthesis
(2R)-2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
pharmaceutical intermediate
Fmoc-cys (acm)(CAS 86060-81-3)의 국제 HS 코드는 2930.90입니다.
2930.90
2930 90 16
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2R)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
CSMYOORPUGPKAP-IBGZPJMESA-N
CC(=O)NCSC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Fmoc-cys (acm) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.