FMOC-CYS(ME)-OH is a research reagent consisting of a cysteine derivative protected with a fluorenylmethoxycarbonyl (Fmoc) group and methylated on the sulfur atom. It is primarily used in peptide synthesis as a building block for introducing S-methyl-L-cysteine residues.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 138021-87-1
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
D-FMOC-methionine
Protected amino acid for peptide synthesis
Fmoc-S-tert-butyl-cys
side chain protected amino acid
Fmoc-cys (acm)
side-chain protected amino acid for peptide synthesis
2-isopropoxy-5-methyl-4-(piperidin-4-yl)aniline dihydrochloride
research compound
Magnesium bromide 2,4-dimethoxybenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
Sulfuric acid-d2
deuterated solvent and reagent
(S)-methyl 3-(pyrrolidin-2-yl)benzoate hydrochloride
research compound
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylsulfanylpropanoic acid
SKNJDZVHMNQAGO-KRWDZBQOSA-N
CSC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13