This compound is a deuterium-labeled form of hexadecanoic acid, where four hydrogen atoms at positions 5 and 6 are replaced with deuterium. It is primarily used as an isotopically labeled fatty acid reference standard in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
HEXADECANOIC-5,5,6,6-D4 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Hexacosanoic acid-d4
Stable isotope labeled reference standard
Lignoceric acid-d4-2
Deuterated fatty acid research standard
Meta-topolin
plant growth regulator research tool
Methan-d3-ol, p-toluenesulfonate
research reagent and reference standard
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
Palmitic Acid-d4
Deuterated internal standard for fatty acid analysis
Palmitic Acid-d3
Deuterated fatty acid reference standard
5,5,6,6-tetradeuteriohexadecanoic acid
IPCSVZSSVZVIGE-AREBVXNXSA-N
[2H]C([2H])(CCCCCCCCCC)C([2H])([2H])CCCC(=O)O
HEXADECANOIC-5,5,6,6-D4 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.