This compound is a deuterium-labeled research reagent and reference standard. It is primarily used in analytical and synthetic chemistry for tracing and quantification studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Methan-d3-ol, p-toluenesulfonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
2,3-Difluorobenzyl alcohol
research compound
4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
research reagent
Methyl p-toluenesulfonate
methylating agent in organic synthesis
trideuteriomethyl 4-methylbenzenesulfonate
VUQUOGPMUUJORT-BMSJAHLVSA-N
[2H]C([2H])([2H])OS(=O)(=O)C1=CC=C(C=C1)C
Methan-d3-ol, p-toluenesulfonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.