Meta-topolin is a synthetic cytokinin compound used primarily as a research reagent in plant tissue culture studies. It is investigated for its role in regulating plant growth and development, particularly in mitigating hyperhydricity and improving regeneration efficiency.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Meta-topolin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methan-d3-ol, p-toluenesulfonate
research reagent and reference standard
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
2,3-Difluorobenzyl alcohol
research compound
6-Benzylaminopurine
plant growth regulator
3-[(7H-purin-6-ylamino)methyl]phenol
BUDWTFCZGZYQHZ-UHFFFAOYSA-N
C1=CC(=CC(=C1)O)CNC2=NC=NC3=C2NC=N3
Meta-topolin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.