1,4-Dimethoxybenzene-d10 is a deuterated form of 1,4-dimethoxybenzene where all hydrogen atoms are replaced by deuterium. It is primarily used as a stable isotope-labeled research reagent for analytical and laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 74079-00-8
(1S,2S)-2-AMINOCYCLOHEXANOL
research compound
Di(succinimido) carbonate
coupling reagent for peptide synthesis
AMP-PCP (disodium)
research compound
ADA sodium salt
biological buffer reagent
1,4-Dimethoxybenzene
Fixative in perfumes and flavoring additive
1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene
OHBQPCCCRFSCAX-ZGYYUIRESA-N
[2H]C1=C(C(=C(C(=C1OC([2H])([2H])[2H])[2H])[2H])OC([2H])([2H])[2H])[2H]