Di(succinimido) carbonate is a research reagent used as a coupling agent in peptide synthesis. Its structure consists of two succinimidyl groups linked by a carbonate moiety, which facilitates the formation of amide bonds under mild conditions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 74124-79-1
(Dimethylamino)((2,5-dioxopyrrolidin-1-yl)oxy)-N,N-dimethylmethaniminium hexafluorophosphate
coupling reagent for peptide synthesis
CD-i
coupling reagent for peptide synthesis
AMP-PCP (disodium)
research compound
ADA sodium salt
biological buffer reagent
Guanosine-5'-diphosphate disodium salt
nucleoside diphosphate research reagent
2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol
Certified reference standard
bis(2,5-dioxopyrrolidin-1-yl) carbonate
PFYXSUNOLOJMDX-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O