This compound is a peptide research reagent consisting of a protected dipeptide structure featuring two proline residues with a benzyloxycarbonyl (Cbz) protecting group. Its primary significance lies in its use as a specialized synthetic intermediate for peptide-related studies and chemical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Carbobenzoxyproline
Protected amino acid intermediate
N-(Carbobenzyloxy)-DL-proline
research compound
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
1-Carbobenzoxy-2-piperidinecarboxylic Acid
pharmaceutical intermediate for peptide synthesis
Triethylamine trihydrofluoride
fluorinating reagent for organic synthesis
Butyric-d7 acid
Deuterated research reference standard
5-ANDROSTEN-3BETA,17BETA-DIOL-16,16,17-D3
isotopically labeled research standard
N-Tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid
biological buffer substance
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid
GEAZFVPWHCGNLW-UHFFFAOYSA-N
C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3=CC=CC=C3)C(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.