1-Carbobenzoxy-2-piperidinecarboxylic acid is a protected piperidine derivative used primarily as a building block in peptide synthesis. Its structure features a carbobenzoxy (Cbz) protecting group attached to the nitrogen atom of the piperidine ring, with a carboxylic acid functional group available for further coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Carbobenzoxy-2-piperidinecarboxylic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Carbobenzoxyproline
Protected amino acid intermediate
N-(Carbobenzyloxy)-DL-proline
research compound
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid
Peptide research compound
1-(1,1-Dimethylethyl) (2S,4S)-4-phenyl-1,2-pyrrolidinedicarboxylate
pharmaceutical intermediate for peptide synthesis
O-tert-Butyl-L-tyrosine
pharmaceutical intermediate for peptide synthesis
Benzyl (2S)-2-amino-4-methylpentanoate hydrochloride
pharmaceutical intermediate for peptide synthesis
1-tert-Butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate
Pharmaceutical intermediate for synthesis
1-phenylmethoxycarbonylpiperidine-2-carboxylic acid
ZSAIHAKADPJIGN-UHFFFAOYSA-N
C1CCN(C(C1)C(=O)O)C(=O)OCC2=CC=CC=C2
1-Carbobenzoxy-2-piperidinecarboxylic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.