5-bromo-2-chloro-N-cyclopentyl-4-pyrimidinamine is a research compound that serves as a laboratory reagent for chemical and biological studies. Its structure features a pyrimidine ring substituted with bromine, chlorine, and a cyclopentylamine group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
5-bromo-2-chloro-N-cyclopentyl-4-Pyrimidinamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,10-DECANEDIOIC-D16 ACID
Deuterated analytical reference standard
Tert-Butylamine borane
Borane reducing agent complex
3-Bromobenzothiophene
Research compound for chemical synthesis
Trans-2,3-Dimethoxycinnamic acid
research compound
5-bromo-2-chloro-N-cyclopentylpyrimidin-4-amine
DIVUXBABVYOIOT-UHFFFAOYSA-N
C1CCC(C1)NC2=NC(=NC=C2Br)Cl
5-bromo-2-chloro-N-cyclopentyl-4-Pyrimidinamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.