Diphenyliodonium nitrate is an iodonium salt used as a laboratory research reagent. It consists of a diphenyliodonium cation paired with a nitrate anion and features two aromatic rings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Diphenyliodonium nitrate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Diphenyliodonium chloride
research reagent
2-Chloro-5-iodotoluene
laboratory research reagent
Hexafluoroisopropyl trifluoroacetate
laboratory research reagent
5-Hydroxy-6-nitronicotinic acid
laboratory research reagent
4-IODOBENZOIC ACID
laboratory research reagent
2,4-Difluorobenzylamine
research compound
6-(benzyloxy)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-ol
synthetic intermediate for research
4-Bromo-3-methylbenzene-1-sulfonyl chloride
synthetic intermediate for organic chemistry
diphenyliodanium nitrate
CQZCVYWWRJDZBO-UHFFFAOYSA-N
C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[N+](=O)([O-])[O-]
Diphenyliodonium nitrate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.