Hexafluoroisopropyl trifluoroacetate is a fluorinated ester compound commonly utilized as a laboratory research reagent. Its structure features multiple halogen substituents, contributing to its high molecular weight and lipophilic character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Hexafluoroisopropyl trifluoroacetate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-Hydroxy-6-nitronicotinic acid
laboratory research reagent
4-IODOBENZOIC ACID
laboratory research reagent
Diphenyliodonium nitrate
laboratory research reagent
2-Chloro-5-iodotoluene
laboratory research reagent
(R)-1-(4-Methylphenyl)ethanol
Chiral alcohol research compound
Trifluoromethanesulfonyl chloride
synthetic reagent for trifluoromethylation reactions
4-Iodo-m-xylene
laboratory reagent
Palladium(II) trifluoroacetate
Cross-coupling catalyst precursor
1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,2-trifluoroacetate
QFOKVELJLZLFMA-UHFFFAOYSA-N
C(C(F)(F)F)(C(F)(F)F)OC(=O)C(F)(F)F
Hexafluoroisopropyl trifluoroacetate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.