Diphenyliodonium chloride is an iodonium salt used as a research reagent. It consists of a positively charged diphenyliodonium cation paired with a chloride anion.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1483-72-3
Diphenyliodonium nitrate
laboratory research reagent
Methyl 3-(trifluoromethoxy)benzoate
Fine chemical research reagent
4-Methylpyridine-3-Boronic Acid
boronic acid synthetic intermediate
N-ACETYL-L-ALANINE-3,3,3-D3
labeled amino acid derivative
Methyldiphenylphosphine
phosphine ligand for organic synthesis
(4-Methylphenyl)(2,4,6-trimethylphenyl)iodonium trifluoromethanesulfonate
Photoacid generator for polymerization
Iodonium, [4-(octyloxy)phenyl]phenyl-
photoinitiator for polymerization reactions
P-(octyloxyphenyl)phenyliodonium hexafluoroantimonate
photoacid generator for polymerizations
diphenyliodanium chloride
RSJLWBUYLGJOBD-UHFFFAOYSA-M
C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-]