DL-Serine-2,3,3-d3 is a deuterium-labeled form of the amino acid serine, where three hydrogen atoms are replaced with deuterium at the 2,3,3 positions. It is primarily used as a research reagent for tracing and analytical studies involving serine metabolism and protein synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DL-Serine-2,3,3-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Chloro-1H-benzimidazol-2-amine
research compound
3-Fluorobenzenesulfonyl chloride
research reagent
3-Benzyl-3-azabicyclo[3.1.0]hexane
Research reagent
(2,2-Dimethylpropyl)boronic acid
Research reagent for organic synthesis
L-Serine-d2
isotopically labeled research compound
L-Serine-d3
Stable isotope labeled amino acid
DL-Serine
Non-essential amino acid
D-serine
Research compound for neuroscience
2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid
MTCFGRXMJLQNBG-FUDHJZNOSA-N
[2H]C([2H])(C([2H])(C(=O)O)N)O
DL-Serine-2,3,3-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.