3-Fluorobenzenesulfonyl chloride is a chemical compound used as a research reagent. It features a fluorinated aromatic ring and a sulfonyl chloride group, making it suitable for laboratory-scale synthesis and derivatization studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Fluorobenzenesulfonyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Benzyl-3-azabicyclo[3.1.0]hexane
Research reagent
(2,2-Dimethylpropyl)boronic acid
Research reagent for organic synthesis
4-Chlorobenzo[d]thiazol-5-amine
research compound
1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine
deuterated research standard
3-fluorobenzenesulfonyl chloride
OKYSUJVCDXZGKE-UHFFFAOYSA-N
C1=CC(=CC(=C1)S(=O)(=O)Cl)F
3-Fluorobenzenesulfonyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.