This compound is a highly deuterated form of diisopropylamine, used as a research standard in analytical chemistry. Its isotopic labeling makes it valuable for mass spectrometry and nuclear magnetic resonance studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Aminophenol-d4
isotopically labeled research compound
Methyl 2,4-dibromobutanoate
Research reagent
1-(2-hydroxy-6-methoxyphenyl)ethanone
research compound
1-naphthylmagnesium bromide
Grignard reagent for organic synthesis
N,N-Diisopropylammonium tetrazolide
tetrazole amine salt intermediate
N,N-Diisopropylamine
chemical intermediate and catalyst
Diisopropylammonium dichloroacetate
n.a
1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine
UAOMVDZJSHZZME-ZVEBFXSZSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H]
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.