Caproic acid-6,6,6-d3 is a deuterated form of hexanoic acid, specifically labeled with three deuterium atoms at the terminal carbon. It serves as a stable isotope-labeled reference standard for analytical chemistry, primarily used in mass spectrometry and chromatography for quantification and method validation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Caproic acid-6,6,6-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Palmitic Acid-d3
Deuterated fatty acid reference standard
Lauric acid-d3
Deuterated fatty acid reference standard
1,3-diethylbenzene-d14
deuterated reference standard for analytical chemistry
Phenyl vinyl sulfone
Research reagent for organic synthesis
Triethylphosphine
Organic synthesis ligand
1H-Tetrazole-5-carboxylic acid, ethyl ester
research compound
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE
deuterated research reagent
Hexanoic-d11 acid
Deuterated internal standard for research
6,6,6-trideuteriohexanoic acid
FUZZWVXGSFPDMH-FIBGUPNXSA-N
[2H]C([2H])([2H])CCCCC(=O)O
Caproic acid-6,6,6-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.