1,3-Diethylbenzene-d14 is a fully deuterated form of 1,3-diethylbenzene, used primarily as a reference standard in analytical chemistry. Its isotopic labeling provides distinct mass spectrometric characteristics, making it valuable for quantification and calibration in gas chromatography and mass spectrometry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219803-40-3
Caproic acid-6,6,6-d3
deuterated reference standard for analytical chemistry
4-Aminopiperidine-3,3,4,5,5-d5
deuterated research compound
2,5-dichlorophenol-3,4,6-d3
deuterated research reference standard
1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one
Deuterated internal standard for analysis
Cetirizine D4
Deuterated research reference standard
1,2,3,5-tetradeuterio-4,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene
AFZZYIJIWUTJFO-NFUPRKAOSA-N
[2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])C([2H])([2H])[2H])[2H])C([2H])([2H])C([2H])([2H])[2H])[2H]